C15H15N3O — CID 82245169
3-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]methyl]pyridine (PubChem CID 82245169) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]methyl]pyridine.
| Compound Name | 3-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 82245169 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-[[4-(4,5-dihydro-1H-imidazol-2-yl)phenoxy]methyl]pyridine |
| SMILES | c1cncc(COc2ccc(C3=NCCN3)cc2)c1 |
| InChI | InChI=1S/C15H15N3O/c1-2-12(10-16-7-1)11-19-14-5-3-13(4-6-14)15-17-8-9-18-15/h1-7,10H,8-9,11H2,(H,17,18) |
| InChIKey | UGLIYXUOWBVPBE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |