C14H12N4O2 — CID 91682556
5-[4-(pyridin-3-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 91682556) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 5-[4-(pyridin-3-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[4-(pyridin-3-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 91682556 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-[4-(pyridin-3-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(OCc3cccnc3)cc2)o1 |
| InChI | InChI=1S/C14H12N4O2/c15-14-18-17-13(20-14)11-3-5-12(6-4-11)19-9-10-2-1-7-16-8-10/h1-8H,9H2,(H2,15,18) |
| InChIKey | GXDLQPHBLACCLV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |