C17H18N2O2 — CID 82249355
2-[4-[(4-methoxyphenyl)methoxy]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 82249355) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methoxy]phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-[(4-methoxyphenyl)methoxy]phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 82249355 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methoxy]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(COc2ccc(C3=NCCN3)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-20-15-6-2-13(3-7-15)12-21-16-8-4-14(5-9-16)17-18-10-11-19-17/h2-9H,10-12H2,1H3,(H,18,19) |
| InChIKey | VNYHIYFGOQKZHG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |