About 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole
2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 82239981) has the molecular formula C18H19ClN2O
and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 82239981 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | Cc1cc(OCc2ccc(C3=NCCN3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C18H19ClN2O/c1-12-9-16(10-13(2)17(12)19)22-11-14-3-5-15(6-4-14)18-20-7-8-21-18/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,21) |
| InChIKey | GZMPVULQHQTWGN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole (CID 82239981) is 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole is Cc1cc(OCc2ccc(C3=NCCN3)cc2)cc(C)c1Cl.
What is the InChIKey of 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole?
The InChIKey is GZMPVULQHQTWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O/c1-12-9-16(10-13(2)17(12)19)22-11-14-3-5-15(6-4-14)18-20-7-8-21-18/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,21).
What are the key properties of 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole?
2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole has a molecular weight of 314.82 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-chloro-3,5-dimethylphenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 82239981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).