C18H20FN3O — CID 82252766
4-[[4-(4,5-dihydro-1H-imidazol-2-yl)-2-fluorophenoxy]methyl]-N,N-dimethylaniline (PubChem CID 82252766) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-[[4-(4,5-dihydro-1H-imidazol-2-yl)-2-fluorophenoxy]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(4,5-dihydro-1H-imidazol-2-yl)-2-fluorophenoxy]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82252766 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-[[4-(4,5-dihydro-1H-imidazol-2-yl)-2-fluorophenoxy]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(COc2ccc(C3=NCCN3)cc2F)cc1 |
| InChI | InChI=1S/C18H20FN3O/c1-22(2)15-6-3-13(4-7-15)12-23-17-8-5-14(11-16(17)19)18-20-9-10-21-18/h3-8,11H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | JLOWZVOZIPCMCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|