C16H14Cl2N2O — CID 82240126
2-[4-[(2,4-dichlorophenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 82240126) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-[4-[(2,4-dichlorophenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-[(2,4-dichlorophenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 82240126 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[4-[(2,4-dichlorophenoxy)methyl]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | Clc1ccc(OCc2ccc(C3=NCCN3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-13-5-6-15(14(18)9-13)21-10-11-1-3-12(4-2-11)16-19-7-8-20-16/h1-6,9H,7-8,10H2,(H,19,20) |
| InChIKey | SROKPEZQTURWDU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |