C27H36N4O2 — CID 127041641
2-[4-[5-[4-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)phenoxy]pentoxy]phenyl]-4,5,6,7-tetrahydro-1H-1,3-diazepine (PubChem CID 127041641) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[4-[5-[4-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)phenoxy]pentoxy]phenyl]-4,5,6,7-tetrahydro-1H-1,3-diazepine.
| Compound Name | 2-[4-[5-[4-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)phenoxy]pentoxy]phenyl]-4,5,6,7-tetrahydro-1H-1,3-diazepine |
|---|---|
| PubChem CID | 127041641 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-[4-[5-[4-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)phenoxy]pentoxy]phenyl]-4,5,6,7-tetrahydro-1H-1,3-diazepine |
| SMILES | c1cc(C2=NCCCCN2)ccc1OCCCCCOc1ccc(C2=NCCCCN2)cc1 |
| InChI | InChI=1S/C27H36N4O2/c1(6-20-32-24-12-8-22(9-13-24)26-28-16-2-3-17-29-26)7-21-33-25-14-10-23(11-15-25)27-30-18-4-5-19-31-27/h8-15H,1-7,16-21H2,(H,28,29)(H,30,31) |
| InChIKey | NNBJGIMSPGFRKC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|