C27H26N2O3 — CID 45272766
2-[2-[4-(4-phenoxybutoxy)phenyl]-1-benzofuran-6-yl]-4,5-dihydro-1H-imidazole (PubChem CID 45272766) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[2-[4-(4-phenoxybutoxy)phenyl]-1-benzofuran-6-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[2-[4-(4-phenoxybutoxy)phenyl]-1-benzofuran-6-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 45272766 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-[2-[4-(4-phenoxybutoxy)phenyl]-1-benzofuran-6-yl]-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(OCCCCOc2ccc(-c3cc4ccc(C5=NCCN5)cc4o3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-2-6-23(7-3-1)30-16-4-5-17-31-24-12-10-20(11-13-24)25-18-21-8-9-22(19-26(21)32-25)27-28-14-15-29-27/h1-3,6-13,18-19H,4-5,14-17H2,(H,28,29) |
| InChIKey | IJEQAJMRGYMJAG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|