C26H26N2O3 — CID 45271050
2-[4-(5-phenoxypentoxy)phenyl]-1-benzofuran-6-carboximidamide (PubChem CID 45271050) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[4-(5-phenoxypentoxy)phenyl]-1-benzofuran-6-carboximidamide.
| Compound Name | 2-[4-(5-phenoxypentoxy)phenyl]-1-benzofuran-6-carboximidamide |
|---|---|
| PubChem CID | 45271050 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[4-(5-phenoxypentoxy)phenyl]-1-benzofuran-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(-c3ccc(OCCCCCOc4ccccc4)cc3)oc2c1 |
| InChI | InChI=1S/C26H26N2O3/c27-26(28)21-10-9-20-17-24(31-25(20)18-21)19-11-13-23(14-12-19)30-16-6-2-5-15-29-22-7-3-1-4-8-22/h1,3-4,7-14,17-18H,2,5-6,15-16H2,(H3,27,28) |
| InChIKey | PXFLMQILKVTYNR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|