C27H28N2O3 — CID 45270220
2-[4-(3-phenoxypropoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide (PubChem CID 45270220) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[4-(3-phenoxypropoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide.
| Compound Name | 2-[4-(3-phenoxypropoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 45270220 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[4-(3-phenoxypropoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc2oc(-c3ccc(OCCCOc4ccccc4)cc3)cc2c1 |
| InChI | InChI=1S/C27H28N2O3/c1-19(2)29-27(28)21-11-14-25-22(17-21)18-26(32-25)20-9-12-24(13-10-20)31-16-6-15-30-23-7-4-3-5-8-23/h3-5,7-14,17-19H,6,15-16H2,1-2H3,(H2,28,29) |
| InChIKey | ULZKXTLKUADOJK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|