C33H40N4O3 — CID 15954617
N'-propan-2-yl-2-[4-[5-[2-(N'-propan-2-ylcarbamimidoyl)phenoxy]pentoxy]phenyl]-1-benzofuran-5-carboximidamide (PubChem CID 15954617) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is N'-propan-2-yl-2-[4-[5-[2-(N'-propan-2-ylcarbamimidoyl)phenoxy]pentoxy]phenyl]-1-benzofuran-5-carboximidamide.
| Compound Name | N'-propan-2-yl-2-[4-[5-[2-(N'-propan-2-ylcarbamimidoyl)phenoxy]pentoxy]phenyl]-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 15954617 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | N'-propan-2-yl-2-[4-[5-[2-(N'-propan-2-ylcarbamimidoyl)phenoxy]pentoxy]phenyl]-1-benzofuran-5-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc2oc(-c3ccc(OCCCCCOc4ccccc4/C(N)=N/C(C)C)cc3)cc2c1 |
| InChI | InChI=1S/C33H40N4O3/c1-22(2)36-32(34)25-14-17-29-26(20-25)21-31(40-29)24-12-15-27(16-13-24)38-18-8-5-9-19-39-30-11-7-6-10-28(30)33(35)37-23(3)4/h6-7,10-17,20-23H,5,8-9,18-19H2,1-4H3,(H2,34,36)(H2,35,37) |
| InChIKey | VCZJISWHBKYUBI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|