C30H34N2O3 — CID 45271048
2-[4-(6-phenoxyhexoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide (PubChem CID 45271048) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[4-(6-phenoxyhexoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide.
| Compound Name | 2-[4-(6-phenoxyhexoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 45271048 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-[4-(6-phenoxyhexoxy)phenyl]-N'-propan-2-yl-1-benzofuran-5-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc2oc(-c3ccc(OCCCCCCOc4ccccc4)cc3)cc2c1 |
| InChI | InChI=1S/C30H34N2O3/c1-22(2)32-30(31)24-14-17-28-25(20-24)21-29(35-28)23-12-15-27(16-13-23)34-19-9-4-3-8-18-33-26-10-6-5-7-11-26/h5-7,10-17,20-22H,3-4,8-9,18-19H2,1-2H3,(H2,31,32) |
| InChIKey | DAPBXYFMHKUTNA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|