C22H40Cl2N4O — CID 155558192
4-(9-amino-9-propan-2-yliminononoxy)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride (PubChem CID 155558192) has the molecular formula C22H40Cl2N4O and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-(9-amino-9-propan-2-yliminononoxy)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride.
| Compound Name | 4-(9-amino-9-propan-2-yliminononoxy)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 155558192 |
| Molecular Formula | C22H40Cl2N4O |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 4-(9-amino-9-propan-2-yliminononoxy)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride |
| SMILES | CC(C)/N=C(\N)CCCCCCCCOc1ccc(/C(N)=N/C(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C22H38N4O.2ClH/c1-17(2)25-21(23)11-9-7-5-6-8-10-16-27-20-14-12-19(13-15-20)22(24)26-18(3)4;;/h12-15,17-18H,5-11,16H2,1-4H3,(H2,23,25)(H2,24,26);2*1H |
| InChIKey | ADGMXXOKYZRNNX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|