C22H40Br2N4O3 — CID 155516271
N-hydroxy-4-[9-(hydroxyamino)-9-propan-2-yliminononoxy]-N'-propan-2-ylbenzenecarboximidamide;dihydrobromide (PubChem CID 155516271) has the molecular formula C22H40Br2N4O3 and a molecular weight of 568.40 g/mol. Its IUPAC name is N-hydroxy-4-[9-(hydroxyamino)-9-propan-2-yliminononoxy]-N'-propan-2-ylbenzenecarboximidamide;dihydrobromide.
| Compound Name | N-hydroxy-4-[9-(hydroxyamino)-9-propan-2-yliminononoxy]-N'-propan-2-ylbenzenecarboximidamide;dihydrobromide |
|---|---|
| PubChem CID | 155516271 |
| Molecular Formula | C22H40Br2N4O3 |
| Molecular Weight | 568.40 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | N-hydroxy-4-[9-(hydroxyamino)-9-propan-2-yliminononoxy]-N'-propan-2-ylbenzenecarboximidamide;dihydrobromide |
| SMILES | Br.Br.CC(C)/N=C(/CCCCCCCCOc1ccc(/C(=N/C(C)C)NO)cc1)NO |
| InChI | InChI=1S/C22H38N4O3.2BrH/c1-17(2)23-21(25-27)11-9-7-5-6-8-10-16-29-20-14-12-19(13-15-20)22(26-28)24-18(3)4;;/h12-15,17-18,27-28H,5-11,16H2,1-4H3,(H,23,25)(H,24,26);2*1H |
| InChIKey | BVTBKYQHWIIERY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|