C34H52N2O4 — CID 5362368
(NE)-N-[(10E)-1,10-bis(4-hexoxyphenyl)-10-hydroxyiminodecylidene]hydroxylamine (PubChem CID 5362368) has the molecular formula C34H52N2O4 and a molecular weight of 552.80 g/mol. Its IUPAC name is (NE)-N-[(10E)-1,10-bis(4-hexoxyphenyl)-10-hydroxyiminodecylidene]hydroxylamine.
| Compound Name | (NE)-N-[(10E)-1,10-bis(4-hexoxyphenyl)-10-hydroxyiminodecylidene]hydroxylamine |
|---|---|
| PubChem CID | 5362368 |
| Molecular Formula | C34H52N2O4 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.39 |
| IUPAC Name | (NE)-N-[(10E)-1,10-bis(4-hexoxyphenyl)-10-hydroxyiminodecylidene]hydroxylamine |
| SMILES | CCCCCCOc1ccc(/C(CCCCCCCC/C(=N\O)c2ccc(OCCCCCC)cc2)=N/O)cc1 |
| InChI | InChI=1S/C34H52N2O4/c1-3-5-7-15-27-39-31-23-19-29(20-24-31)33(35-37)17-13-11-9-10-12-14-18-34(36-38)30-21-25-32(26-22-30)40-28-16-8-6-4-2/h19-26,37-38H,3-18,27-28H2,1-2H3/b35-33+,36-34+ |
| InChIKey | BWAPCYTWDFJIQW-LBYUQGKWSA-N |
| XLogP | 9.78 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|