About [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate
[4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate (PubChem CID 5140283) has the molecular formula C26H35NO4
and a molecular weight of 425.57 g/mol. Its IUPAC name is [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate.
Molecular Properties
| Compound Name | [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate |
| PubChem CID | 5140283 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(CCCC)=NO)cc2)cc1 |
| InChI | InChI=1S/C26H35NO4/c1-3-5-7-8-9-10-20-30-23-16-14-22(15-17-23)26(28)31-24-18-12-21(13-19-24)25(27-29)11-6-4-2/h12-19,29H,3-11,20H2,1-2H3 |
| InChIKey | CHYHMZBUHUCALD-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate?
The IUPAC name of [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate (CID 5140283) is [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate.
What is the SMILES notation for [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate?
The canonical SMILES for [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate is CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(CCCC)=NO)cc2)cc1.
What is the InChIKey of [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate?
The InChIKey is CHYHMZBUHUCALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35NO4/c1-3-5-7-8-9-10-20-30-23-16-14-22(15-17-23)26(28)31-24-18-12-21(13-19-24)25(27-29)11-6-4-2/h12-19,29H,3-11,20H2,1-2H3.
What are the key properties of [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate?
[4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate has a molecular weight of 425.57 g/mol, XLogP of 7.01, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(C-butyl-N-hydroxycarbonimidoyl)phenyl] 4-octoxybenzoate is sourced from PubChem (CID 5140283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).