C30H46O2S2 — CID 101102640
1,2-bis(4-octoxyphenyl)ethane-1,2-dithiol (PubChem CID 101102640) has the molecular formula C30H46O2S2 and a molecular weight of 502.83 g/mol. Its IUPAC name is 1,2-bis(4-octoxyphenyl)ethane-1,2-dithiol.
| Compound Name | 1,2-bis(4-octoxyphenyl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 101102640 |
| Molecular Formula | C30H46O2S2 |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 1,2-bis(4-octoxyphenyl)ethane-1,2-dithiol |
| SMILES | CCCCCCCCOc1ccc(C(S)C(S)c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C30H46O2S2/c1-3-5-7-9-11-13-23-31-27-19-15-25(16-20-27)29(33)30(34)26-17-21-28(22-18-26)32-24-14-12-10-8-6-4-2/h15-22,29-30,33-34H,3-14,23-24H2,1-2H3 |
| InChIKey | FQIAIQBIYDKELS-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|