C47H66N6O9 — CID 142380100
4-[6-[3,5-bis[6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]hexoxy]phenoxy]hexoxy]-N'-hydroxybenzenecarboximidamide;ethane (PubChem CID 142380100) has the molecular formula C47H66N6O9 and a molecular weight of 859.08 g/mol. Its IUPAC name is 4-[6-[3,5-bis[6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]hexoxy]phenoxy]hexoxy]-N'-hydroxybenzenecarboximidamide;ethane.
| Compound Name | 4-[6-[3,5-bis[6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]hexoxy]phenoxy]hexoxy]-N'-hydroxybenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 142380100 |
| Molecular Formula | C47H66N6O9 |
| Molecular Weight | 859.08 g/mol |
| Exact Mass | 858.49 |
| IUPAC Name | 4-[6-[3,5-bis[6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]hexoxy]phenoxy]hexoxy]-N'-hydroxybenzenecarboximidamide;ethane |
| SMILES | CC.N/C(=N\O)c1ccc(OCCCCCCOc2cc(OCCCCCCOc3ccc(/C(N)=N/O)cc3)cc(OCCCCCCOc3ccc(/C(N)=N/O)cc3)c2)cc1 |
| InChI | InChI=1S/C45H60N6O9.C2H6/c46-43(49-52)34-13-19-37(20-14-34)55-25-7-1-4-10-28-58-40-31-41(59-29-11-5-2-8-26-56-38-21-15-35(16-22-38)44(47)50-53)33-42(32-40)60-30-12-6-3-9-27-57-39-23-17-36(18-24-39)45(48)51-54;1-2/h13-24,31-33,52-54H,1-12,25-30H2,(H2,46,49)(H2,47,50)(H2,48,51);1-2H3 |
| InChIKey | CRTKZOBXKYNTTO-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 231.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.08 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|