C17H20N4O4 — CID 5480201
N'-hydroxy-4-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]propoxy]benzenecarboximidamide (PubChem CID 5480201) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N'-hydroxy-4-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]propoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 5480201 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N'-hydroxy-4-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]propoxy]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(OCCCOc2ccc(/C(N)=N/O)cc2)cc1 |
| InChI | InChI=1S/C17H20N4O4/c18-16(20-22)12-2-6-14(7-3-12)24-10-1-11-25-15-8-4-13(5-9-15)17(19)21-23/h2-9,22-23H,1,10-11H2,(H2,18,20)(H2,19,21) |
| InChIKey | JZZQSMIQUPQSCL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|