C12H19N3O3 — CID 77029004
N'-hydroxy-4-[2-(3-hydroxypropylamino)ethoxy]benzenecarboximidamide (PubChem CID 77029004) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N'-hydroxy-4-[2-(3-hydroxypropylamino)ethoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[2-(3-hydroxypropylamino)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 77029004 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N'-hydroxy-4-[2-(3-hydroxypropylamino)ethoxy]benzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCCNCCCO)cc1 |
| InChI | InChI=1S/C12H19N3O3/c13-12(15-17)10-2-4-11(5-3-10)18-9-7-14-6-1-8-16/h2-5,14,16-17H,1,6-9H2,(H2,13,15) |
| InChIKey | MYWMJTDHXYYMHM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|