C15H25N3O3 — CID 82941754
N'-hydroxy-4-[2-(3-propoxypropylamino)ethoxy]benzenecarboximidamide (PubChem CID 82941754) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N'-hydroxy-4-[2-(3-propoxypropylamino)ethoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[2-(3-propoxypropylamino)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 82941754 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N'-hydroxy-4-[2-(3-propoxypropylamino)ethoxy]benzenecarboximidamide |
| SMILES | CCCOCCCNCCOc1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C15H25N3O3/c1-2-10-20-11-3-8-17-9-12-21-14-6-4-13(5-7-14)15(16)18-19/h4-7,17,19H,2-3,8-12H2,1H3,(H2,16,18) |
| InChIKey | RKFNMGSSLSMFTF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|