C13H20N4O3 — CID 77027995
4-[2-[4-(N'-hydroxycarbamimidoyl)phenoxy]ethylamino]butanamide (PubChem CID 77027995) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[2-[4-(N'-hydroxycarbamimidoyl)phenoxy]ethylamino]butanamide.
| Compound Name | 4-[2-[4-(N'-hydroxycarbamimidoyl)phenoxy]ethylamino]butanamide |
|---|---|
| PubChem CID | 77027995 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 4-[2-[4-(N'-hydroxycarbamimidoyl)phenoxy]ethylamino]butanamide |
| SMILES | NC(=O)CCCNCCOc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C13H20N4O3/c14-12(18)2-1-7-16-8-9-20-11-5-3-10(4-6-11)13(15)17-19/h3-6,16,19H,1-2,7-9H2,(H2,14,18)(H2,15,17) |
| InChIKey | VJFWJRFTJAUPOA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|