C13H21N3O3 — CID 77025374
4-[2-(2-ethoxyethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 77025374) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[2-(2-ethoxyethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-(2-ethoxyethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77025374 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[2-(2-ethoxyethylamino)ethoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCOCCNCCOc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C13H21N3O3/c1-2-18-9-7-15-8-10-19-12-5-3-11(4-6-12)13(14)16-17/h3-6,15,17H,2,7-10H2,1H3,(H2,14,16) |
| InChIKey | JXGYUIXMDGDVQC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|