C15H23N3O3 — CID 114468068
N'-hydroxy-4-[2-[2-(2-methylprop-2-enoxy)ethylamino]ethoxy]benzenecarboximidamide (PubChem CID 114468068) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N'-hydroxy-4-[2-[2-(2-methylprop-2-enoxy)ethylamino]ethoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[2-[2-(2-methylprop-2-enoxy)ethylamino]ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 114468068 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N'-hydroxy-4-[2-[2-(2-methylprop-2-enoxy)ethylamino]ethoxy]benzenecarboximidamide |
| SMILES | C=C(C)COCCNCCOc1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C15H23N3O3/c1-12(2)11-20-9-7-17-8-10-21-14-5-3-13(4-6-14)15(16)18-19/h3-6,17,19H,1,7-11H2,2H3,(H2,16,18) |
| InChIKey | DLTOVZUDCNDLKA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|