C11H13F3N2O2 — CID 113326452
N'-hydroxy-4-(4,4,4-trifluorobutoxy)benzenecarboximidamide (PubChem CID 113326452) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is N'-hydroxy-4-(4,4,4-trifluorobutoxy)benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(4,4,4-trifluorobutoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 113326452 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N'-hydroxy-4-(4,4,4-trifluorobutoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O2/c12-11(13,14)6-1-7-18-9-4-2-8(3-5-9)10(15)16-17/h2-5,17H,1,6-7H2,(H2,15,16) |
| InChIKey | ULFIJBSLTQSFMT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|