About 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide
4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide (PubChem CID 144860221) has the molecular formula C12H17BrN2OS
and a molecular weight of 317.25 g/mol. Its IUPAC name is 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide |
| PubChem CID | 144860221 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide |
| SMILES | CS/N=C(\N)c1ccc(OCCCCBr)cc1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-17-15-12(14)10-4-6-11(7-5-10)16-9-3-2-8-13/h4-7H,2-3,8-9H2,1H3,(H2,14,15) |
| InChIKey | SIKSSUNLPPRBOL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide?
The IUPAC name of 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide (CID 144860221) is 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide.
What is the SMILES notation for 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide?
The canonical SMILES for 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide is CS/N=C(\N)c1ccc(OCCCCBr)cc1.
What is the InChIKey of 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide?
The InChIKey is SIKSSUNLPPRBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2OS/c1-17-15-12(14)10-4-6-11(7-5-10)16-9-3-2-8-13/h4-7H,2-3,8-9H2,1H3,(H2,14,15).
What are the key properties of 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide?
4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide has a molecular weight of 317.25 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromobutoxy)-N'-methylsulfanylbenzenecarboximidamide is sourced from PubChem (CID 144860221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).