C15H21BrN2O3 — CID 165083505
tert-butyl N-[amino-[4-(3-bromopropoxy)phenyl]methylidene]carbamate (PubChem CID 165083505) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is tert-butyl N-[amino-[4-(3-bromopropoxy)phenyl]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[4-(3-bromopropoxy)phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 165083505 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | tert-butyl N-[amino-[4-(3-bromopropoxy)phenyl]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)c1ccc(OCCCBr)cc1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-15(2,3)21-14(19)18-13(17)11-5-7-12(8-6-11)20-10-4-9-16/h5-8H,4,9-10H2,1-3H3,(H2,17,18,19) |
| InChIKey | MSUPFKSAULNYAP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|