C17H24N2O4 — CID 54481576
1-[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]butyl formate (PubChem CID 54481576) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]butyl formate.
| Compound Name | 1-[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]butyl formate |
|---|---|
| PubChem CID | 54481576 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]butyl formate |
| SMILES | CCCC(OC=O)c1ccc(C(N)=NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-5-6-14(22-11-20)12-7-9-13(10-8-12)15(18)19-16(21)23-17(2,3)4/h7-11,14H,5-6H2,1-4H3,(H2,18,19,21) |
| InChIKey | JCPVEZRMLWDEFQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|