About 1-phenylpentyl formate
1-phenylpentyl formate (PubChem CID 54289292) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-phenylpentyl formate.
Molecular Properties
| Compound Name | 1-phenylpentyl formate |
| PubChem CID | 54289292 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 1-phenylpentyl formate |
| SMILES | CCCCC(OC=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-2-3-9-12(14-10-13)11-7-5-4-6-8-11/h4-8,10,12H,2-3,9H2,1H3 |
| InChIKey | NDEOEQGXRYFWLE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpentyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpentyl formate?
The IUPAC name of 1-phenylpentyl formate (CID 54289292) is 1-phenylpentyl formate.
What is the SMILES notation for 1-phenylpentyl formate?
The canonical SMILES for 1-phenylpentyl formate is CCCCC(OC=O)c1ccccc1.
What is the InChIKey of 1-phenylpentyl formate?
The InChIKey is NDEOEQGXRYFWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-3-9-12(14-10-13)11-7-5-4-6-8-11/h4-8,10,12H,2-3,9H2,1H3.
What are the key properties of 1-phenylpentyl formate?
1-phenylpentyl formate has a molecular weight of 192.26 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpentyl formate is sourced from PubChem (CID 54289292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).