About 1-phenylnonyl formate
1-phenylnonyl formate (PubChem CID 174585088) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-phenylnonyl formate.
Molecular Properties
| Compound Name | 1-phenylnonyl formate |
| PubChem CID | 174585088 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-phenylnonyl formate |
| SMILES | CCCCCCCCC(OC=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-5-6-10-13-16(18-14-17)15-11-8-7-9-12-15/h7-9,11-12,14,16H,2-6,10,13H2,1H3 |
| InChIKey | AHXYWNALIJOYAB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylnonyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylnonyl formate?
The IUPAC name of 1-phenylnonyl formate (CID 174585088) is 1-phenylnonyl formate.
What is the SMILES notation for 1-phenylnonyl formate?
The canonical SMILES for 1-phenylnonyl formate is CCCCCCCCC(OC=O)c1ccccc1.
What is the InChIKey of 1-phenylnonyl formate?
The InChIKey is AHXYWNALIJOYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2/c1-2-3-4-5-6-10-13-16(18-14-17)15-11-8-7-9-12-15/h7-9,11-12,14,16H,2-6,10,13H2,1H3.
What are the key properties of 1-phenylnonyl formate?
1-phenylnonyl formate has a molecular weight of 248.37 g/mol, XLogP of 4.65, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylnonyl formate is sourced from PubChem (CID 174585088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).