About (2-ethyl-1-phenyldecyl) formate
(2-ethyl-1-phenyldecyl) formate (PubChem CID 174631629) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is (2-ethyl-1-phenyldecyl) formate.
Molecular Properties
| Compound Name | (2-ethyl-1-phenyldecyl) formate |
| PubChem CID | 174631629 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2-ethyl-1-phenyldecyl) formate |
| SMILES | CCCCCCCCC(CC)C(OC=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O2/c1-3-5-6-7-8-10-13-17(4-2)19(21-16-20)18-14-11-9-12-15-18/h9,11-12,14-17,19H,3-8,10,13H2,1-2H3 |
| InChIKey | VMVHCIZNHMESKD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-1-phenyldecyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1-phenyldecyl) formate?
The IUPAC name of (2-ethyl-1-phenyldecyl) formate (CID 174631629) is (2-ethyl-1-phenyldecyl) formate.
What is the SMILES notation for (2-ethyl-1-phenyldecyl) formate?
The canonical SMILES for (2-ethyl-1-phenyldecyl) formate is CCCCCCCCC(CC)C(OC=O)c1ccccc1.
What is the InChIKey of (2-ethyl-1-phenyldecyl) formate?
The InChIKey is VMVHCIZNHMESKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-3-5-6-7-8-10-13-17(4-2)19(21-16-20)18-14-11-9-12-15-18/h9,11-12,14-17,19H,3-8,10,13H2,1-2H3.
What are the key properties of (2-ethyl-1-phenyldecyl) formate?
(2-ethyl-1-phenyldecyl) formate has a molecular weight of 290.45 g/mol, XLogP of 5.68, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1-phenyldecyl) formate is sourced from PubChem (CID 174631629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).