About 1-ethoxydecylbenzene
1-ethoxydecylbenzene (PubChem CID 71423896) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-ethoxydecylbenzene.
Molecular Properties
| Compound Name | 1-ethoxydecylbenzene |
| PubChem CID | 71423896 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-ethoxydecylbenzene |
| SMILES | CCCCCCCCCC(OCC)c1ccccc1 |
| InChI | InChI=1S/C18H30O/c1-3-5-6-7-8-9-13-16-18(19-4-2)17-14-11-10-12-15-17/h10-12,14-15,18H,3-9,13,16H2,1-2H3 |
| InChIKey | KQGABGXGOVCINQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxydecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxydecylbenzene?
The IUPAC name of 1-ethoxydecylbenzene (CID 71423896) is 1-ethoxydecylbenzene.
What is the SMILES notation for 1-ethoxydecylbenzene?
The canonical SMILES for 1-ethoxydecylbenzene is CCCCCCCCCC(OCC)c1ccccc1.
What is the InChIKey of 1-ethoxydecylbenzene?
The InChIKey is KQGABGXGOVCINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-3-5-6-7-8-9-13-16-18(19-4-2)17-14-11-10-12-15-17/h10-12,14-15,18H,3-9,13,16H2,1-2H3.
What are the key properties of 1-ethoxydecylbenzene?
1-ethoxydecylbenzene has a molecular weight of 262.44 g/mol, XLogP of 5.90, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxydecylbenzene is sourced from PubChem (CID 71423896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).