About 1-pentoxybutylbenzene
1-pentoxybutylbenzene (PubChem CID 173061669) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-pentoxybutylbenzene.
Molecular Properties
| Compound Name | 1-pentoxybutylbenzene |
| PubChem CID | 173061669 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-pentoxybutylbenzene |
| SMILES | CCCCCOC(CCC)c1ccccc1 |
| InChI | InChI=1S/C15H24O/c1-3-5-9-13-16-15(10-4-2)14-11-7-6-8-12-14/h6-8,11-12,15H,3-5,9-10,13H2,1-2H3 |
| InChIKey | FFLYOHSOZRWCSE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxybutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxybutylbenzene?
The IUPAC name of 1-pentoxybutylbenzene (CID 173061669) is 1-pentoxybutylbenzene.
What is the SMILES notation for 1-pentoxybutylbenzene?
The canonical SMILES for 1-pentoxybutylbenzene is CCCCCOC(CCC)c1ccccc1.
What is the InChIKey of 1-pentoxybutylbenzene?
The InChIKey is FFLYOHSOZRWCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-3-5-9-13-16-15(10-4-2)14-11-7-6-8-12-14/h6-8,11-12,15H,3-5,9-10,13H2,1-2H3.
What are the key properties of 1-pentoxybutylbenzene?
1-pentoxybutylbenzene has a molecular weight of 220.36 g/mol, XLogP of 4.73, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxybutylbenzene is sourced from PubChem (CID 173061669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).