About 1-pentoxypropylbenzene
1-pentoxypropylbenzene (PubChem CID 57033372) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-pentoxypropylbenzene.
Molecular Properties
| Compound Name | 1-pentoxypropylbenzene |
| PubChem CID | 57033372 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1-pentoxypropylbenzene |
| SMILES | CCCCCOC(CC)c1ccccc1 |
| InChI | InChI=1S/C14H22O/c1-3-5-9-12-15-14(4-2)13-10-7-6-8-11-13/h6-8,10-11,14H,3-5,9,12H2,1-2H3 |
| InChIKey | ORRZUTKLFKIAAD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxypropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxypropylbenzene?
The IUPAC name of 1-pentoxypropylbenzene (CID 57033372) is 1-pentoxypropylbenzene.
What is the SMILES notation for 1-pentoxypropylbenzene?
The canonical SMILES for 1-pentoxypropylbenzene is CCCCCOC(CC)c1ccccc1.
What is the InChIKey of 1-pentoxypropylbenzene?
The InChIKey is ORRZUTKLFKIAAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-3-5-9-12-15-14(4-2)13-10-7-6-8-11-13/h6-8,10-11,14H,3-5,9,12H2,1-2H3.
What are the key properties of 1-pentoxypropylbenzene?
1-pentoxypropylbenzene has a molecular weight of 206.33 g/mol, XLogP of 4.34, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxypropylbenzene is sourced from PubChem (CID 57033372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).