About 1-pentoxyethylbenzene;hydrate
1-pentoxyethylbenzene;hydrate (PubChem CID 174634303) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-pentoxyethylbenzene;hydrate.
Molecular Properties
| Compound Name | 1-pentoxyethylbenzene;hydrate |
| PubChem CID | 174634303 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1-pentoxyethylbenzene;hydrate |
| SMILES | CCCCCOC(C)c1ccccc1.O |
| InChI | InChI=1S/C13H20O.H2O/c1-3-4-8-11-14-12(2)13-9-6-5-7-10-13;/h5-7,9-10,12H,3-4,8,11H2,1-2H3;1H2 |
| InChIKey | WAYBBUUZQCQLDT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxyethylbenzene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxyethylbenzene;hydrate?
The IUPAC name of 1-pentoxyethylbenzene;hydrate (CID 174634303) is 1-pentoxyethylbenzene;hydrate.
What is the SMILES notation for 1-pentoxyethylbenzene;hydrate?
The canonical SMILES for 1-pentoxyethylbenzene;hydrate is CCCCCOC(C)c1ccccc1.O.
What is the InChIKey of 1-pentoxyethylbenzene;hydrate?
The InChIKey is WAYBBUUZQCQLDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O.H2O/c1-3-4-8-11-14-12(2)13-9-6-5-7-10-13;/h5-7,9-10,12H,3-4,8,11H2,1-2H3;1H2.
What are the key properties of 1-pentoxyethylbenzene;hydrate?
1-pentoxyethylbenzene;hydrate has a molecular weight of 210.32 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxyethylbenzene;hydrate is sourced from PubChem (CID 174634303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).