About 1-dodecoxyhexylbenzene
1-dodecoxyhexylbenzene (PubChem CID 174774790) has the molecular formula C24H42O
and a molecular weight of 346.60 g/mol. Its IUPAC name is 1-dodecoxyhexylbenzene.
Molecular Properties
| Compound Name | 1-dodecoxyhexylbenzene |
| PubChem CID | 174774790 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 1-dodecoxyhexylbenzene |
| SMILES | CCCCCCCCCCCCOC(CCCCC)c1ccccc1 |
| InChI | InChI=1S/C24H42O/c1-3-5-7-8-9-10-11-12-13-18-22-25-24(21-15-6-4-2)23-19-16-14-17-20-23/h14,16-17,19-20,24H,3-13,15,18,21-22H2,1-2H3 |
| InChIKey | GJXINMGJHORPAQ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecoxyhexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecoxyhexylbenzene?
The IUPAC name of 1-dodecoxyhexylbenzene (CID 174774790) is 1-dodecoxyhexylbenzene.
What is the SMILES notation for 1-dodecoxyhexylbenzene?
The canonical SMILES for 1-dodecoxyhexylbenzene is CCCCCCCCCCCCOC(CCCCC)c1ccccc1.
What is the InChIKey of 1-dodecoxyhexylbenzene?
The InChIKey is GJXINMGJHORPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O/c1-3-5-7-8-9-10-11-12-13-18-22-25-24(21-15-6-4-2)23-19-16-14-17-20-23/h14,16-17,19-20,24H,3-13,15,18,21-22H2,1-2H3.
What are the key properties of 1-dodecoxyhexylbenzene?
1-dodecoxyhexylbenzene has a molecular weight of 346.60 g/mol, XLogP of 8.25, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecoxyhexylbenzene is sourced from PubChem (CID 174774790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).