About nonoxy(phenyl)methanol
nonoxy(phenyl)methanol (PubChem CID 70405769) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is nonoxy(phenyl)methanol.
Molecular Properties
| Compound Name | nonoxy(phenyl)methanol |
| PubChem CID | 70405769 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | nonoxy(phenyl)methanol |
| SMILES | CCCCCCCCCOC(O)c1ccccc1 |
| InChI | InChI=1S/C16H26O2/c1-2-3-4-5-6-7-11-14-18-16(17)15-12-9-8-10-13-15/h8-10,12-13,16-17H,2-7,11,14H2,1H3 |
| InChIKey | VIJBMKDMIGBLTO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze nonoxy(phenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonoxy(phenyl)methanol?
The IUPAC name of nonoxy(phenyl)methanol (CID 70405769) is nonoxy(phenyl)methanol.
What is the SMILES notation for nonoxy(phenyl)methanol?
The canonical SMILES for nonoxy(phenyl)methanol is CCCCCCCCCOC(O)c1ccccc1.
What is the InChIKey of nonoxy(phenyl)methanol?
The InChIKey is VIJBMKDMIGBLTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-2-3-4-5-6-7-11-14-18-16(17)15-12-9-8-10-13-15/h8-10,12-13,16-17H,2-7,11,14H2,1H3.
What are the key properties of nonoxy(phenyl)methanol?
nonoxy(phenyl)methanol has a molecular weight of 250.38 g/mol, XLogP of 4.44, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonoxy(phenyl)methanol is sourced from PubChem (CID 70405769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).