C15H24O5 — CID 146666211
5-[hydroxy(octoxy)methyl]benzene-1,2,3-triol (PubChem CID 146666211) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 5-[hydroxy(octoxy)methyl]benzene-1,2,3-triol.
| Compound Name | 5-[hydroxy(octoxy)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 146666211 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-[hydroxy(octoxy)methyl]benzene-1,2,3-triol |
| SMILES | CCCCCCCCOC(O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H24O5/c1-2-3-4-5-6-7-8-20-15(19)11-9-12(16)14(18)13(17)10-11/h9-10,15-19H,2-8H2,1H3 |
| InChIKey | KIFHOWNKAPMDTM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|