C12H18O3 — CID 54026211
5-hexylbenzene-1,2,3-triol (PubChem CID 54026211) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 5-hexylbenzene-1,2,3-triol.
| Compound Name | 5-hexylbenzene-1,2,3-triol |
|---|---|
| PubChem CID | 54026211 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-hexylbenzene-1,2,3-triol |
| SMILES | CCCCCCc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-6-9-7-10(13)12(15)11(14)8-9/h7-8,13-15H,2-6H2,1H3 |
| InChIKey | IVCDWMGQIYOYCJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|