C13H16O4 — CID 158818763
2-(2,3-dihydroxy-5-pentylphenyl)-2-oxoacetaldehyde (PubChem CID 158818763) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(2,3-dihydroxy-5-pentylphenyl)-2-oxoacetaldehyde.
| Compound Name | 2-(2,3-dihydroxy-5-pentylphenyl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 158818763 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(2,3-dihydroxy-5-pentylphenyl)-2-oxoacetaldehyde |
| SMILES | CCCCCc1cc(O)c(O)c(C(=O)C=O)c1 |
| InChI | InChI=1S/C13H16O4/c1-2-3-4-5-9-6-10(12(16)8-14)13(17)11(15)7-9/h6-8,15,17H,2-5H2,1H3 |
| InChIKey | GBAQLWLGUFLNOJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|