C23H38O3Zn — CID 170425717
2-hydroxy-3,5-dioctylbenzoic acid;zinc (PubChem CID 170425717) has the molecular formula C23H38O3Zn and a molecular weight of 427.94 g/mol. Its IUPAC name is 2-hydroxy-3,5-dioctylbenzoic acid;zinc.
| Compound Name | 2-hydroxy-3,5-dioctylbenzoic acid;zinc |
|---|---|
| PubChem CID | 170425717 |
| Molecular Formula | C23H38O3Zn |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-hydroxy-3,5-dioctylbenzoic acid;zinc |
| SMILES | CCCCCCCCc1cc(CCCCCCCC)c(O)c(C(=O)O)c1.[Zn] |
| InChI | InChI=1S/C23H38O3.Zn/c1-3-5-7-9-11-13-15-19-17-20(16-14-12-10-8-6-4-2)22(24)21(18-19)23(25)26;/h17-18,24H,3-16H2,1-2H3,(H,25,26); |
| InChIKey | JFDSMTSEQHMAOV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|