C16H26O4 — CID 139655568
2-[2-[2-(1-phenylbutoxy)ethoxy]ethoxy]ethanol (PubChem CID 139655568) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[2-[2-(1-phenylbutoxy)ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(1-phenylbutoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 139655568 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[2-[2-(1-phenylbutoxy)ethoxy]ethoxy]ethanol |
| SMILES | CCCC(OCCOCCOCCO)c1ccccc1 |
| InChI | InChI=1S/C16H26O4/c1-2-6-16(15-7-4-3-5-8-15)20-14-13-19-12-11-18-10-9-17/h3-5,7-8,16-17H,2,6,9-14H2,1H3 |
| InChIKey | GTOOFALCHPNZLD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|