C13H20O3 — CID 175154206
3-(1-phenylbutoxy)propane-1,2-diol (PubChem CID 175154206) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(1-phenylbutoxy)propane-1,2-diol.
| Compound Name | 3-(1-phenylbutoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 175154206 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-(1-phenylbutoxy)propane-1,2-diol |
| SMILES | CCCC(OCC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C13H20O3/c1-2-6-13(16-10-12(15)9-14)11-7-4-3-5-8-11/h3-5,7-8,12-15H,2,6,9-10H2,1H3 |
| InChIKey | KOHWGJWONSEWAS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |