C10H13IO2 — CID 125483394
2-[(1S)-2-iodo-1-phenylethoxy]ethanol (PubChem CID 125483394) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-[(1S)-2-iodo-1-phenylethoxy]ethanol.
| Compound Name | 2-[(1S)-2-iodo-1-phenylethoxy]ethanol |
|---|---|
| PubChem CID | 125483394 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-[(1S)-2-iodo-1-phenylethoxy]ethanol |
| SMILES | OCCO[C@H](CI)c1ccccc1 |
| InChI | InChI=1S/C10H13IO2/c11-8-10(13-7-6-12)9-4-2-1-3-5-9/h1-5,10,12H,6-8H2/t10-/m1/s1 |
| InChIKey | QPWVDYNDGVKXNX-SNVBAGLBSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|