C54H73N3O10 — CID 59475402
2-[2-[bis[2-[bis[2-(2-hydroxyethoxy)-2-phenylethyl]amino]ethyl]amino]-1-phenylethoxy]ethanol (PubChem CID 59475402) has the molecular formula C54H73N3O10 and a molecular weight of 924.19 g/mol. Its IUPAC name is 2-[2-[bis[2-[bis[2-(2-hydroxyethoxy)-2-phenylethyl]amino]ethyl]amino]-1-phenylethoxy]ethanol.
| Compound Name | 2-[2-[bis[2-[bis[2-(2-hydroxyethoxy)-2-phenylethyl]amino]ethyl]amino]-1-phenylethoxy]ethanol |
|---|---|
| PubChem CID | 59475402 |
| Molecular Formula | C54H73N3O10 |
| Molecular Weight | 924.19 g/mol |
| Exact Mass | 923.53 |
| IUPAC Name | 2-[2-[bis[2-[bis[2-(2-hydroxyethoxy)-2-phenylethyl]amino]ethyl]amino]-1-phenylethoxy]ethanol |
| SMILES | OCCOC(CN(CCN(CC(OCCO)c1ccccc1)CC(OCCO)c1ccccc1)CCN(CC(OCCO)c1ccccc1)CC(OCCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H73N3O10/c58-30-35-63-50(45-16-6-1-7-17-45)40-55(26-28-56(41-51(64-36-31-59)46-18-8-2-9-19-46)42-52(65-37-32-60)47-20-10-3-11-21-47)27-29-57(43-53(66-38-33-61)48-22-12-4-13-23-48)44-54(67-39-34-62)49-24-14-5-15-25-49/h1-25,50-54,58-62H,26-44H2 |
| InChIKey | SXUJMXYQJGJBEW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.19 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |