C11H15IO3 — CID 51051061
(2R,3S)-3-(2-hydroxyethoxy)-2-iodo-3-phenylpropan-1-ol (PubChem CID 51051061) has the molecular formula C11H15IO3 and a molecular weight of 322.14 g/mol. Its IUPAC name is (2R,3S)-3-(2-hydroxyethoxy)-2-iodo-3-phenylpropan-1-ol.
| Compound Name | (2R,3S)-3-(2-hydroxyethoxy)-2-iodo-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 51051061 |
| Molecular Formula | C11H15IO3 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | (2R,3S)-3-(2-hydroxyethoxy)-2-iodo-3-phenylpropan-1-ol |
| SMILES | OCCO[C@@H](c1ccccc1)[C@H](I)CO |
| InChI | InChI=1S/C11H15IO3/c12-10(8-14)11(15-7-6-13)9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | PNCRHLGPEBOZSF-MNOVXSKESA-N |
| XLogP | 1.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|