C18H20Br2O2 — CID 10717396
[1,2-bis(2-bromoethoxy)-2-phenylethyl]benzene (PubChem CID 10717396) has the molecular formula C18H20Br2O2 and a molecular weight of 428.16 g/mol. Its IUPAC name is [1,2-bis(2-bromoethoxy)-2-phenylethyl]benzene.
| Compound Name | [1,2-bis(2-bromoethoxy)-2-phenylethyl]benzene |
|---|---|
| PubChem CID | 10717396 |
| Molecular Formula | C18H20Br2O2 |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | [1,2-bis(2-bromoethoxy)-2-phenylethyl]benzene |
| SMILES | BrCCOC(c1ccccc1)C(OCCBr)c1ccccc1 |
| InChI | InChI=1S/C18H20Br2O2/c19-11-13-21-17(15-7-3-1-4-8-15)18(22-14-12-20)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | VJJHTPPTIUZZDO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|