C18H20O2 — CID 102243904
(1R,2S)-2-but-3-enoxy-1,2-diphenylethanol (PubChem CID 102243904) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (1R,2S)-2-but-3-enoxy-1,2-diphenylethanol.
| Compound Name | (1R,2S)-2-but-3-enoxy-1,2-diphenylethanol |
|---|---|
| PubChem CID | 102243904 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (1R,2S)-2-but-3-enoxy-1,2-diphenylethanol |
| SMILES | C=CCCO[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-2-3-14-20-18(16-12-8-5-9-13-16)17(19)15-10-6-4-7-11-15/h2,4-13,17-19H,1,3,14H2/t17-,18+/m1/s1 |
| InChIKey | VHOBGCHEFJOJOY-MSOLQXFVSA-N |
| XLogP | 4.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|