C17H18O2 — CID 11821143
2-ethenyl-1,3-diphenylpropane-1,3-diol (PubChem CID 11821143) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-ethenyl-1,3-diphenylpropane-1,3-diol.
| Compound Name | 2-ethenyl-1,3-diphenylpropane-1,3-diol |
|---|---|
| PubChem CID | 11821143 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-ethenyl-1,3-diphenylpropane-1,3-diol |
| SMILES | C=CC(C(O)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H18O2/c1-2-15(16(18)13-9-5-3-6-10-13)17(19)14-11-7-4-8-12-14/h2-12,15-19H,1H2 |
| InChIKey | CJBAJFPGTDZACG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|