About benzene;1-phenylprop-2-en-1-ol
benzene;1-phenylprop-2-en-1-ol (PubChem CID 174884403) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is benzene;1-phenylprop-2-en-1-ol.
Molecular Properties
| Compound Name | benzene;1-phenylprop-2-en-1-ol |
| PubChem CID | 174884403 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | benzene;1-phenylprop-2-en-1-ol |
| SMILES | C=CC(O)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C9H10O.C6H6/c1-2-9(10)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h2-7,9-10H,1H2;1-6H |
| InChIKey | PQWJGGAJRAZQKW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzene;1-phenylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-phenylprop-2-en-1-ol?
The IUPAC name of benzene;1-phenylprop-2-en-1-ol (CID 174884403) is benzene;1-phenylprop-2-en-1-ol.
What is the SMILES notation for benzene;1-phenylprop-2-en-1-ol?
The canonical SMILES for benzene;1-phenylprop-2-en-1-ol is C=CC(O)c1ccccc1.c1ccccc1.
What is the InChIKey of benzene;1-phenylprop-2-en-1-ol?
The InChIKey is PQWJGGAJRAZQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C6H6/c1-2-9(10)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h2-7,9-10H,1H2;1-6H.
What are the key properties of benzene;1-phenylprop-2-en-1-ol?
benzene;1-phenylprop-2-en-1-ol has a molecular weight of 212.29 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-phenylprop-2-en-1-ol is sourced from PubChem (CID 174884403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).